See image — IUPAC and Nomenclature Chemistry Question

💡 Solution & Explanation

Step 1: Identify the structure. The molecule is CH3-CO-CO-CH3, which consists of two carbonyl (C=O) groups connected to each other, with methyl groups on each end. This gives a 4-carbon chain. Step 2: Identify the parent chain. The longest carbon chain contains 4 carbons: C1(CH3)-C2(=O)-C3(=O)-C4(CH3). The parent chain is butane. Step 3: Identify the functional groups. There are two ketone (C=O) groups. The suffix for two ketone groups is '-dione'. Step 4: Number the chain. The carbonyl groups are at positions 2 and 3 (numbering from either end gives the same result: positions 2 and 3). So the compound is butane-2,3-dione. Step 5: Eliminate incorrect options. - (a) Butane-2,3-dial: '-dial' refers to two aldehyde groups, not ketone groups. Incorrect. - (b) Butane-1,3-dione: positions 1 and 3 would place one carbonyl at the terminal carbon (which would be an aldehyde, not a ketone). Incorrect. - (d) 1,2-dimethylethanedione: This incorrectly names the compound as an ethanedione with methyl substituents. The correct approach is to include all carbons in the parent chain, giving butane, not ethane with substituents. Incorrect. - (c) Butane-2,3-dione: Correct parent chain (butane), correct suffix (dione), correct locants (2 and 3). This is the IUPAC name. Therefore, the correct answer is C.