See image — IUPAC and Nomenclature Chemistry Question

💡 Solution & Explanation

Step 1: Identify the longest carbon chain containing the nitrogen-bearing carbon. The structure shows a central carbon bearing an NH2 group, connected to a butyl group (4 carbons: -CH2-CH2-CH2-CH3) on one side and an ethyl group (2 carbons: -CH2-CH3) on the other side. Step 2: Count the total carbons in the longest chain. The ethyl group contributes 2 carbons, the central carbon bearing NH2 contributes 1, and the butyl group contributes 4 carbons, giving a total of 2 + 1 + 4 = 7 carbons. This is a heptane backbone. Step 3: Number the chain to give the NH2 group the lowest possible locant. Numbering from the ethyl end: C1-C2-C3(NH2)-C4-C5-C6-C7. The NH2 is at carbon 3, giving locant 3. Numbering from the butyl end would place NH2 at carbon 5, which is higher. So numbering from the ethyl end is correct. Step 4: Name the compound. The parent chain is heptane, the substituent is an amino group (-NH2) at position 3, so the name is heptan-3-amine. No other substituents are present. Therefore, the correct answer is heptan-3-amine.